C54H34N8 — CID 156556541
12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole (PubChem CID 156556541) has the molecular formula C54H34N8 and a molecular weight of 794.92 g/mol. Its IUPAC name is 12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole.
| Compound Name | 12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
|---|---|
| PubChem CID | 156556541 |
| Molecular Formula | C54H34N8 |
| Molecular Weight | 794.92 g/mol |
| Exact Mass | 794.29 |
| IUPAC Name | 12-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-11-phenylindolo[2,3-a]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4nc(-c5ccccc5)nc(-n5c6ccccc6c6ccc7c8ccccc8n(-c8ccccc8)c7c65)n4)cc3)n2)cc1 |
| InChI | InChI=1S/C54H34N8/c1-5-17-35(18-6-1)49-55-50(36-19-7-2-8-20-36)57-51(56-49)38-29-31-39(32-30-38)53-58-52(37-21-9-3-10-22-37)59-54(60-53)62-46-28-16-14-26-42(46)44-34-33-43-41-25-13-15-27-45(41)61(47(43)48(44)62)40-23-11-4-12-24-40/h1-34H |
| InChIKey | JJEUAGZGQBBZHK-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.92 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |