C19H28O4 — CID 15655713
trans-diethyl (3R,4S)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclohexane-1,1-dicarboxylate (PubChem CID 15655713) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is trans-diethyl (3R,4S)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclohexane-1,1-dicarboxylate.
| Compound Name | trans-diethyl (3R,4S)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15655713 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | trans-diethyl (3R,4S)-3-[(1E)-buta-1,3-dienyl]-4-prop-2-enylcyclohexane-1,1-dicarboxylate |
| SMILES | C=C/C=C/[C@@H]1CC(C(=O)OCC)(C(=O)OCC)CC[C@H]1CC=C |
| InChI | InChI=1S/C19H28O4/c1-5-9-11-16-14-19(17(20)22-7-3,18(21)23-8-4)13-12-15(16)10-6-2/h5-6,9,11,15-16H,1-2,7-8,10,12-14H2,3-4H3/b11-9+/t15-,16-/m1/s1 |
| InChIKey | QNGQGXRTESGWMM-BVPRHBRVSA-N |
| XLogP | 3.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|