C19H15F3N2O — CID 156558710
2-(trifluoromethyl)-4-(3,3,5-trimethyl-2-oxoindol-1-yl)benzonitrile (PubChem CID 156558710) has the molecular formula C19H15F3N2O and a molecular weight of 344.34 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-(3,3,5-trimethyl-2-oxoindol-1-yl)benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-(3,3,5-trimethyl-2-oxoindol-1-yl)benzonitrile |
|---|---|
| PubChem CID | 156558710 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(trifluoromethyl)-4-(3,3,5-trimethyl-2-oxoindol-1-yl)benzonitrile |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=O)N2c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H15F3N2O/c1-11-4-7-16-15(8-11)18(2,3)17(25)24(16)13-6-5-12(10-23)14(9-13)19(20,21)22/h4-9H,1-3H3 |
| InChIKey | ZUEIXADNMKFTIJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |