C12H22N2O3 — CID 156561109
(3aR)-N,1,6-trimethyl-4-propan-2-yloxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-imine (PubChem CID 156561109) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (3aR)-N,1,6-trimethyl-4-propan-2-yloxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-imine.
| Compound Name | (3aR)-N,1,6-trimethyl-4-propan-2-yloxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-imine |
|---|---|
| PubChem CID | 156561109 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (3aR)-N,1,6-trimethyl-4-propan-2-yloxy-4,6,7,7a-tetrahydro-3aH-pyrano[4,3-d][1,3]oxazol-2-imine |
| SMILES | C/N=C1\O[C@H]2C(OC(C)C)OC(C)CC2N1C |
| InChI | InChI=1S/C12H22N2O3/c1-7(2)15-11-10-9(6-8(3)16-11)14(5)12(13-4)17-10/h7-11H,6H2,1-5H3/b13-12-/t8?,9?,10-,11?/m1/s1 |
| InChIKey | FDOCZUBLYUKNHC-COXKFDNJSA-N |
| XLogP | 1.23 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|