C29H36N4O4S — CID 156561785
2-methyl-N-[(6-methyl-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[(1R)-1-[4-(oxetan-3-yloxyimino)cyclohexyl]ethyl]indole-3-carboxamide (PubChem CID 156561785) has the molecular formula C29H36N4O4S and a molecular weight of 536.70 g/mol. Its IUPAC name is 2-methyl-N-[(6-methyl-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[(1R)-1-[4-(oxetan-3-yloxyimino)cyclohexyl]ethyl]indole-3-carboxamide.
| Compound Name | 2-methyl-N-[(6-methyl-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[(1R)-1-[4-(oxetan-3-yloxyimino)cyclohexyl]ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 156561785 |
| Molecular Formula | C29H36N4O4S |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 2-methyl-N-[(6-methyl-4-methylsulfanyl-2-oxo-1H-pyridin-3-yl)methyl]-1-[(1R)-1-[4-(oxetan-3-yloxyimino)cyclohexyl]ethyl]indole-3-carboxamide |
| SMILES | CSc1cc(C)[nH]c(=O)c1CNC(=O)c1c(C)n([C@H](C)C2CCC(=NOC3COC3)CC2)c2ccccc12 |
| InChI | InChI=1S/C29H36N4O4S/c1-17-13-26(38-4)24(28(34)31-17)14-30-29(35)27-19(3)33(25-8-6-5-7-23(25)27)18(2)20-9-11-21(12-10-20)32-37-22-15-36-16-22/h5-8,13,18,20,22H,9-12,14-16H2,1-4H3,(H,30,35)(H,31,34)/b32-21-/t18-,20?/m1/s1 |
| InChIKey | SWXLSXAQVNFWJI-VIMNENTLSA-N |
| XLogP | 5.12 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|