C15H10N4O3 — CID 156562164
12-(2-hydroxyphenyl)-4,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-3,7-dione (PubChem CID 156562164) has the molecular formula C15H10N4O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 12-(2-hydroxyphenyl)-4,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-3,7-dione.
| Compound Name | 12-(2-hydroxyphenyl)-4,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-3,7-dione |
|---|---|
| PubChem CID | 156562164 |
| Molecular Formula | C15H10N4O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 12-(2-hydroxyphenyl)-4,8,10,11-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-3,7-dione |
| SMILES | O=C1NCc2c1c1cc(-c3ccccc3O)nnc1[nH]c2=O |
| InChI | InChI=1S/C15H10N4O3/c20-11-4-2-1-3-7(11)10-5-8-12-9(6-16-15(12)22)14(21)17-13(8)19-18-10/h1-5,20H,6H2,(H,16,22)(H,17,19,21) |
| InChIKey | GUUHQFVRBHNEHM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |