About (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine
(2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine (PubChem CID 156562697) has the molecular formula C10H16ClN
and a molecular weight of 185.70 g/mol. Its IUPAC name is (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine |
| PubChem CID | 156562697 |
| Molecular Formula | C10H16ClN |
| Molecular Weight | 185.70 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C(/C)Cl)CCCC |
| InChI | InChI=1S/C10H16ClN/c1-3-4-5-10(8-12)7-6-9(2)11/h6-8,12H,3-5H2,1-2H3/b9-6+,10-7-,12-8+ |
| InChIKey | DWHRLAHURGVGCD-FTAWPAHLSA-N |
| XLogP | 3.90 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.70 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine?
The IUPAC name of (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine (CID 156562697) is (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine.
What is the SMILES notation for (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine?
The canonical SMILES for (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine is [H]/N=C/C(=C\C=C(/C)Cl)CCCC.
What is the InChIKey of (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine?
The InChIKey is DWHRLAHURGVGCD-FTAWPAHLSA-N. The full InChI is InChI=1S/C10H16ClN/c1-3-4-5-10(8-12)7-6-9(2)11/h6-8,12H,3-5H2,1-2H3/b9-6+,10-7-,12-8+.
What are the key properties of (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine?
(2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine has a molecular weight of 185.70 g/mol, XLogP of 3.90, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-2-butyl-5-chlorohexa-2,4-dien-1-imine is sourced from PubChem (CID 156562697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).