C4H4Br2Cl4 — CID 15656285
1,2-dibromo-1,3,4,4-tetrachlorobutane (PubChem CID 15656285) has the molecular formula C4H4Br2Cl4 and a molecular weight of 353.70 g/mol. Its IUPAC name is 1,2-dibromo-1,3,4,4-tetrachlorobutane.
| Compound Name | 1,2-dibromo-1,3,4,4-tetrachlorobutane |
|---|---|
| PubChem CID | 15656285 |
| Molecular Formula | C4H4Br2Cl4 |
| Molecular Weight | 353.70 g/mol |
| Exact Mass | 349.74 |
| IUPAC Name | 1,2-dibromo-1,3,4,4-tetrachlorobutane |
| SMILES | ClC(Cl)C(Cl)C(Br)C(Cl)Br |
| InChI | InChI=1S/C4H4Br2Cl4/c5-1(3(6)8)2(7)4(9)10/h1-4H |
| InChIKey | OMGDRNWQNLRDKF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.70 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|