About 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one
8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one (PubChem CID 156562875) has the molecular formula C11H9ClN6O
and a molecular weight of 276.69 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one |
| PubChem CID | 156562875 |
| Molecular Formula | C11H9ClN6O |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one |
| SMILES | NNc1[nH]c(=O)nc2nc(-c3ccc(Cl)cc3)[nH]c12 |
| InChI | InChI=1S/C11H9ClN6O/c12-6-3-1-5(2-4-6)8-14-7-9(15-8)16-11(19)17-10(7)18-13/h1-4H,13H2,(H3,14,15,16,17,18,19) |
| InChIKey | IEWSISCLKKBRRK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one?
The IUPAC name of 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one (CID 156562875) is 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one.
What is the SMILES notation for 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one?
The canonical SMILES for 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one is NNc1[nH]c(=O)nc2nc(-c3ccc(Cl)cc3)[nH]c12.
What is the InChIKey of 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one?
The InChIKey is IEWSISCLKKBRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN6O/c12-6-3-1-5(2-4-6)8-14-7-9(15-8)16-11(19)17-10(7)18-13/h1-4H,13H2,(H3,14,15,16,17,18,19).
What are the key properties of 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one?
8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one has a molecular weight of 276.69 g/mol, XLogP of 1.25, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-chlorophenyl)-6-hydrazinyl-1,7-dihydropurin-2-one is sourced from PubChem (CID 156562875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).