About [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate
[(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate (PubChem CID 156563152) has the molecular formula C16H22F2N4O4
and a molecular weight of 372.37 g/mol. Its IUPAC name is [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate.
Molecular Properties
| Compound Name | [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate |
| PubChem CID | 156563152 |
| Molecular Formula | C16H22F2N4O4 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate |
| SMILES | COc1c(N2CC[C@@H](OC(=O)NC3CCC(F)(F)CC3)C2)cn[nH]c1=O |
| InChI | InChI=1S/C16H22F2N4O4/c1-25-13-12(8-19-21-14(13)23)22-7-4-11(9-22)26-15(24)20-10-2-5-16(17,18)6-3-10/h8,10-11H,2-7,9H2,1H3,(H,20,24)(H,21,23)/t11-/m1/s1 |
| InChIKey | MRJJNUNWDOZUFN-LLVKDONJSA-N |
| XLogP | 1.66 |
| TPSA | 96.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate?
The IUPAC name of [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate (CID 156563152) is [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate.
What is the SMILES notation for [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate?
The canonical SMILES for [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate is COc1c(N2CC[C@@H](OC(=O)NC3CCC(F)(F)CC3)C2)cn[nH]c1=O.
What is the InChIKey of [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate?
The InChIKey is MRJJNUNWDOZUFN-LLVKDONJSA-N. The full InChI is InChI=1S/C16H22F2N4O4/c1-25-13-12(8-19-21-14(13)23)22-7-4-11(9-22)26-15(24)20-10-2-5-16(17,18)6-3-10/h8,10-11H,2-7,9H2,1H3,(H,20,24)(H,21,23)/t11-/m1/s1.
What are the key properties of [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate?
[(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate has a molecular weight of 372.37 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-(5-methoxy-6-oxo-1H-pyridazin-4-yl)pyrrolidin-3-yl] N-(4,4-difluorocyclohexyl)carbamate is sourced from PubChem (CID 156563152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).