C17H18ClF3N4O2 — CID 156563365
tert-butyl 11-chloro-3-cyclopropyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate (PubChem CID 156563365) has the molecular formula C17H18ClF3N4O2 and a molecular weight of 402.80 g/mol. Its IUPAC name is tert-butyl 11-chloro-3-cyclopropyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate.
| Compound Name | tert-butyl 11-chloro-3-cyclopropyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 156563365 |
| Molecular Formula | C17H18ClF3N4O2 |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | tert-butyl 11-chloro-3-cyclopropyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C2CC2)(C(F)(F)F)c2c1cnc1cc(Cl)nn21 |
| InChI | InChI=1S/C17H18ClF3N4O2/c1-15(2,3)27-14(26)24-8-16(9-4-5-9,17(19,20)21)13-10(24)7-22-12-6-11(18)23-25(12)13/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | WDAAMXMLTIKBEU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |