C21H19ClF5N7O2 — CID 156563453
5-[[[(3R)-11-chloro-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-5-yl]-hydroxymethyl]amino]-N-cyclopropyl-3-(difluoromethyl)pyridine-2-carboxamide (PubChem CID 156563453) has the molecular formula C21H19ClF5N7O2 and a molecular weight of 531.87 g/mol. Its IUPAC name is 5-[[[(3R)-11-chloro-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-5-yl]-hydroxymethyl]amino]-N-cyclopropyl-3-(difluoromethyl)pyridine-2-carboxamide.
| Compound Name | 5-[[[(3R)-11-chloro-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-5-yl]-hydroxymethyl]amino]-N-cyclopropyl-3-(difluoromethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156563453 |
| Molecular Formula | C21H19ClF5N7O2 |
| Molecular Weight | 531.87 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 5-[[[(3R)-11-chloro-3-methyl-3-(trifluoromethyl)-1,5,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-5-yl]-hydroxymethyl]amino]-N-cyclopropyl-3-(difluoromethyl)pyridine-2-carboxamide |
| SMILES | C[C@@]1(C(F)(F)F)CN(C(O)Nc2cnc(C(=O)NC3CC3)c(C(F)F)c2)c2cnc3cc(Cl)nn3c21 |
| InChI | InChI=1S/C21H19ClF5N7O2/c1-20(21(25,26)27)8-33(12-7-28-14-5-13(22)32-34(14)16(12)20)19(36)31-10-4-11(17(23)24)15(29-6-10)18(35)30-9-2-3-9/h4-7,9,17,19,31,36H,2-3,8H2,1H3,(H,30,35)/t19?,20-/m1/s1 |
| InChIKey | KJLZNWDHHSJGMD-GFOWMXPYSA-N |
| XLogP | 3.64 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|