About 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol
1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol (PubChem CID 156563500) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol.
Molecular Properties
| Compound Name | 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol |
| PubChem CID | 156563500 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol |
| SMILES | CC(C)C1C=C(O)N(C)C1 |
| InChI | InChI=1S/C8H15NO/c1-6(2)7-4-8(10)9(3)5-7/h4,6-7,10H,5H2,1-3H3 |
| InChIKey | MDHRSWXCBXAQPW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol?
The IUPAC name of 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol (CID 156563500) is 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol.
What is the SMILES notation for 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol?
The canonical SMILES for 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol is CC(C)C1C=C(O)N(C)C1.
What is the InChIKey of 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol?
The InChIKey is MDHRSWXCBXAQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-6(2)7-4-8(10)9(3)5-7/h4,6-7,10H,5H2,1-3H3.
What are the key properties of 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol?
1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol has a molecular weight of 141.21 g/mol, XLogP of 1.60, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propan-2-yl-2,3-dihydropyrrol-5-ol is sourced from PubChem (CID 156563500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).