About N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine
N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine (PubChem CID 156563566) has the molecular formula C7H12N4OS
and a molecular weight of 200.27 g/mol. Its IUPAC name is N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine.
Molecular Properties
| Compound Name | N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine |
| PubChem CID | 156563566 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine |
| SMILES | SNCC1(Cn2cncn2)COC1 |
| InChI | InChI=1S/C7H12N4OS/c13-10-1-7(3-12-4-7)2-11-6-8-5-9-11/h5-6,10,13H,1-4H2 |
| InChIKey | FQHROCGOSOOMLS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine?
The IUPAC name of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine (CID 156563566) is N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine.
What is the SMILES notation for N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine?
The canonical SMILES for N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine is SNCC1(Cn2cncn2)COC1.
What is the InChIKey of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine?
The InChIKey is FQHROCGOSOOMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4OS/c13-10-1-7(3-12-4-7)2-11-6-8-5-9-11/h5-6,10,13H,1-4H2.
What are the key properties of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine?
N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine has a molecular weight of 200.27 g/mol, XLogP of -0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]thiohydroxylamine is sourced from PubChem (CID 156563566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).