About N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine
N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine (PubChem CID 156563763) has the molecular formula C10H18N4O
and a molecular weight of 210.28 g/mol. Its IUPAC name is N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine |
| PubChem CID | 156563763 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(Cn2cncn2)COC1 |
| InChI | InChI=1S/C10H18N4O/c1-9(2)12-3-10(5-15-6-10)4-14-8-11-7-13-14/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | QDDRAPNUZREIJW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine?
The IUPAC name of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine (CID 156563763) is N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine is CC(C)NCC1(Cn2cncn2)COC1.
What is the InChIKey of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine?
The InChIKey is QDDRAPNUZREIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O/c1-9(2)12-3-10(5-15-6-10)4-14-8-11-7-13-14/h7-9,12H,3-6H2,1-2H3.
What are the key properties of N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine?
N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine has a molecular weight of 210.28 g/mol, XLogP of 0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(1,2,4-triazol-1-ylmethyl)oxetan-3-yl]methyl]propan-2-amine is sourced from PubChem (CID 156563763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).