About 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine
4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine (PubChem CID 156564313) has the molecular formula C19H20ClFN4
and a molecular weight of 358.85 g/mol. Its IUPAC name is 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine |
| PubChem CID | 156564313 |
| Molecular Formula | C19H20ClFN4 |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine |
| SMILES | Cc1cc(Nc2ccc(Cl)c(F)c2)ccc1NCCCn1cccn1 |
| InChI | InChI=1S/C19H20ClFN4/c1-14-12-15(24-16-4-6-17(20)18(21)13-16)5-7-19(14)22-8-2-10-25-11-3-9-23-25/h3-7,9,11-13,22,24H,2,8,10H2,1H3 |
| InChIKey | XGPDUSKJRKBALO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine?
The IUPAC name of 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine (CID 156564313) is 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine.
What is the SMILES notation for 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine?
The canonical SMILES for 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine is Cc1cc(Nc2ccc(Cl)c(F)c2)ccc1NCCCn1cccn1.
What is the InChIKey of 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine?
The InChIKey is XGPDUSKJRKBALO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClFN4/c1-14-12-15(24-16-4-6-17(20)18(21)13-16)5-7-19(14)22-8-2-10-25-11-3-9-23-25/h3-7,9,11-13,22,24H,2,8,10H2,1H3.
What are the key properties of 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine?
4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine has a molecular weight of 358.85 g/mol, XLogP of 5.23, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(4-chloro-3-fluorophenyl)-2-methyl-1-N-(3-pyrazol-1-ylpropyl)benzene-1,4-diamine is sourced from PubChem (CID 156564313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).