C11H21N2O2P — CID 156564533
(1Z,3Z)-1-[diethoxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)penta-1,3-dien-2-amine (PubChem CID 156564533) has the molecular formula C11H21N2O2P and a molecular weight of 244.27 g/mol. Its IUPAC name is (1Z,3Z)-1-[diethoxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)penta-1,3-dien-2-amine.
| Compound Name | (1Z,3Z)-1-[diethoxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 156564533 |
| Molecular Formula | C11H21N2O2P |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (1Z,3Z)-1-[diethoxy(methylidene)-λ5-phosphanyl]-1-(methylideneamino)penta-1,3-dien-2-amine |
| SMILES | C=N/C(=C(N)\C=C/C)P(=C)(OCC)OCC |
| InChI | InChI=1S/C11H21N2O2P/c1-6-9-10(12)11(13-4)16(5,14-7-2)15-8-3/h6,9H,4-5,7-8,12H2,1-3H3/b9-6-,11-10- |
| InChIKey | BCPWRBZTIWQGHQ-ONEMGQKZSA-N |
| XLogP | 2.74 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|