C15H5F17O — CID 156565364
[(E)-1,1,1,2,2,3,5,6,7,7,7-undecafluoro-4,6-bis(trifluoromethyl)hept-4-en-3-yl]oxybenzene (PubChem CID 156565364) has the molecular formula C15H5F17O and a molecular weight of 524.17 g/mol. Its IUPAC name is [(E)-1,1,1,2,2,3,5,6,7,7,7-undecafluoro-4,6-bis(trifluoromethyl)hept-4-en-3-yl]oxybenzene.
| Compound Name | [(E)-1,1,1,2,2,3,5,6,7,7,7-undecafluoro-4,6-bis(trifluoromethyl)hept-4-en-3-yl]oxybenzene |
|---|---|
| PubChem CID | 156565364 |
| Molecular Formula | C15H5F17O |
| Molecular Weight | 524.17 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | [(E)-1,1,1,2,2,3,5,6,7,7,7-undecafluoro-4,6-bis(trifluoromethyl)hept-4-en-3-yl]oxybenzene |
| SMILES | F/C(=C(/C(F)(F)F)C(F)(Oc1ccccc1)C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H5F17O/c16-8(9(17,13(24,25)26)14(27,28)29)7(11(19,20)21)10(18,12(22,23)15(30,31)32)33-6-4-2-1-3-5-6/h1-5H/b8-7+ |
| InChIKey | GOZLVJTWRGPGDU-BQYQJAHWSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.17 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|