C17H14F2N4O4 — CID 156565668
2-(difluoromethoxy)-N-[[3-(2,3-dihydroxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide (PubChem CID 156565668) has the molecular formula C17H14F2N4O4 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-(difluoromethoxy)-N-[[3-(2,3-dihydroxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide.
| Compound Name | 2-(difluoromethoxy)-N-[[3-(2,3-dihydroxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 156565668 |
| Molecular Formula | C17H14F2N4O4 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-(difluoromethoxy)-N-[[3-(2,3-dihydroxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]benzamide |
| SMILES | O=C(NCc1nc(-c2cccc(O)c2O)n[nH]1)c1ccccc1OC(F)F |
| InChI | InChI=1S/C17H14F2N4O4/c18-17(19)27-12-7-2-1-4-9(12)16(26)20-8-13-21-15(23-22-13)10-5-3-6-11(24)14(10)25/h1-7,17,24-25H,8H2,(H,20,26)(H,21,22,23) |
| InChIKey | FATCLCMXNHTINM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|