C22H21Cl2F4N7O3 — CID 156565835
4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carbonyl azide;4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carboxylic acid (PubChem CID 156565835) has the molecular formula C22H21Cl2F4N7O3 and a molecular weight of 578.35 g/mol. Its IUPAC name is 4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carbonyl azide;4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carboxylic acid.
| Compound Name | 4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carbonyl azide;4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 156565835 |
| Molecular Formula | C22H21Cl2F4N7O3 |
| Molecular Weight | 578.35 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carbonyl azide;4-chloro-5-(4,4-difluoropiperidin-1-yl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)c(N2CCC(F)(F)CC2)cn1.[N-]=[N+]=NC(=O)c1cc(Cl)c(N2CCC(F)(F)CC2)cn1 |
| InChI | InChI=1S/C11H10ClF2N5O.C11H11ClF2N2O2/c12-7-5-8(10(20)17-18-15)16-6-9(7)19-3-1-11(13,14)2-4-19;12-7-5-8(10(17)18)15-6-9(7)16-3-1-11(13,14)2-4-16/h5-6H,1-4H2;5-6H,1-4H2,(H,17,18) |
| InChIKey | HJWRBJKEDRDREN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 135.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.35 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|