C21H25Cl2F3N8O4 — CID 156565847
1-(3-chloro-5-nitro-2-pyridinyl)piperazine;1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine (PubChem CID 156565847) has the molecular formula C21H25Cl2F3N8O4 and a molecular weight of 581.38 g/mol. Its IUPAC name is 1-(3-chloro-5-nitro-2-pyridinyl)piperazine;1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 1-(3-chloro-5-nitro-2-pyridinyl)piperazine;1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 156565847 |
| Molecular Formula | C21H25Cl2F3N8O4 |
| Molecular Weight | 581.38 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | 1-(3-chloro-5-nitro-2-pyridinyl)piperazine;1-(3-chloro-5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine |
| SMILES | O=[N+]([O-])c1cnc(N2CCN(CCC(F)(F)F)CC2)c(Cl)c1.O=[N+]([O-])c1cnc(N2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H14ClF3N4O2.C9H11ClN4O2/c13-10-7-9(20(21)22)8-17-11(10)19-5-3-18(4-6-19)2-1-12(14,15)16;10-8-5-7(14(15)16)6-12-9(8)13-3-1-11-2-4-13/h7-8H,1-6H2;5-6,11H,1-4H2 |
| InChIKey | STBTVTYFJPVPKY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|