C20H22ClF4N7O4 — CID 156565891
4-chloro-2-(4,4-difluoropiperidin-1-yl)-5-nitropyridine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine (PubChem CID 156565891) has the molecular formula C20H22ClF4N7O4 and a molecular weight of 535.89 g/mol. Its IUPAC name is 4-chloro-2-(4,4-difluoropiperidin-1-yl)-5-nitropyridine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine.
| Compound Name | 4-chloro-2-(4,4-difluoropiperidin-1-yl)-5-nitropyridine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine |
|---|---|
| PubChem CID | 156565891 |
| Molecular Formula | C20H22ClF4N7O4 |
| Molecular Weight | 535.89 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | 4-chloro-2-(4,4-difluoropiperidin-1-yl)-5-nitropyridine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine |
| SMILES | Nc1cc(N2CCC(F)(F)CC2)ncc1[N+](=O)[O-].O=[N+]([O-])c1cnc(N2CCC(F)(F)CC2)cc1Cl |
| InChI | InChI=1S/C10H10ClF2N3O2.C10H12F2N4O2/c11-7-5-9(14-6-8(7)16(17)18)15-3-1-10(12,13)2-4-15;11-10(12)1-3-15(4-2-10)9-5-7(13)8(6-14-9)16(17)18/h5-6H,1-4H2;5-6H,1-4H2,(H2,13,14) |
| InChIKey | LPUSHDMLBSUERJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|