About 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine
2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine (PubChem CID 156565939) has the molecular formula C15H16ClF2N7O4
and a molecular weight of 431.79 g/mol. Its IUPAC name is 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine.
Molecular Properties
| Compound Name | 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine |
| PubChem CID | 156565939 |
| Molecular Formula | C15H16ClF2N7O4 |
| Molecular Weight | 431.79 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine |
| SMILES | Nc1cc(Cl)ncc1[N+](=O)[O-].Nc1cc(N2CCC(F)(F)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12F2N4O2.C5H4ClN3O2/c11-10(12)1-3-15(4-2-10)9-5-7(13)8(6-14-9)16(17)18;6-5-1-3(7)4(2-8-5)9(10)11/h5-6H,1-4H2,(H2,13,14);1-2H,(H2,7,8) |
| InChIKey | MNKFTNWRHDIIGY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 167.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.79 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine?
The IUPAC name of 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine (CID 156565939) is 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine.
What is the SMILES notation for 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine?
The canonical SMILES for 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine is Nc1cc(Cl)ncc1[N+](=O)[O-].Nc1cc(N2CCC(F)(F)CC2)ncc1[N+](=O)[O-].
What is the InChIKey of 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine?
The InChIKey is MNKFTNWRHDIIGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N4O2.C5H4ClN3O2/c11-10(12)1-3-15(4-2-10)9-5-7(13)8(6-14-9)16(17)18;6-5-1-3(7)4(2-8-5)9(10)11/h5-6H,1-4H2,(H2,13,14);1-2H,(H2,7,8).
What are the key properties of 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine?
2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine has a molecular weight of 431.79 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-nitropyridin-4-amine;2-(4,4-difluoropiperidin-1-yl)-5-nitropyridin-4-amine is sourced from PubChem (CID 156565939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).