C24H32F6N8O2 — CID 156566036
1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine (PubChem CID 156566036) has the molecular formula C24H32F6N8O2 and a molecular weight of 578.56 g/mol. Its IUPAC name is 1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine.
| Compound Name | 1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 156566036 |
| Molecular Formula | C24H32F6N8O2 |
| Molecular Weight | 578.56 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | 1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine;6-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]pyridin-3-amine |
| SMILES | Nc1ccc(N2CCN(CCC(F)(F)F)CC2)nc1.O=[N+]([O-])c1ccc(N2CCN(CCC(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C12H15F3N4O2.C12H17F3N4/c13-12(14,15)3-4-17-5-7-18(8-6-17)11-2-1-10(9-16-11)19(20)21;13-12(14,15)3-4-18-5-7-19(8-6-18)11-2-1-10(16)9-17-11/h1-2,9H,3-8H2;1-2,9H,3-8,16H2 |
| InChIKey | QSVZXSLDYXQQFE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|