C21H27F3N8O4 — CID 156566091
1-(5-nitro-2-pyridinyl)piperazine;1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine (PubChem CID 156566091) has the molecular formula C21H27F3N8O4 and a molecular weight of 512.49 g/mol. Its IUPAC name is 1-(5-nitro-2-pyridinyl)piperazine;1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine.
| Compound Name | 1-(5-nitro-2-pyridinyl)piperazine;1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine |
|---|---|
| PubChem CID | 156566091 |
| Molecular Formula | C21H27F3N8O4 |
| Molecular Weight | 512.49 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 1-(5-nitro-2-pyridinyl)piperazine;1-(5-nitro-2-pyridinyl)-4-(3,3,3-trifluoropropyl)piperazine |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(CCC(F)(F)F)CC2)nc1.O=[N+]([O-])c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C12H15F3N4O2.C9H12N4O2/c13-12(14,15)3-4-17-5-7-18(8-6-17)11-2-1-10(9-16-11)19(20)21;14-13(15)8-1-2-9(11-7-8)12-5-3-10-4-6-12/h1-2,9H,3-8H2;1-2,7,10H,3-6H2 |
| InChIKey | ZJGIFCVYQLJRNR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 133.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|