C28H33N3O5 — CID 15656621
2-(1,3-dioxoisoindol-2-yl)ethyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate (PubChem CID 15656621) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate |
|---|---|
| PubChem CID | 15656621 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-[4-hydroxy-3,5-bis(pyrrolidin-1-ylmethyl)phenyl]acetate |
| SMILES | O=C(Cc1cc(CN2CCCC2)c(O)c(CN2CCCC2)c1)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H33N3O5/c32-25(36-14-13-31-27(34)23-7-1-2-8-24(23)28(31)35)17-20-15-21(18-29-9-3-4-10-29)26(33)22(16-20)19-30-11-5-6-12-30/h1-2,7-8,15-16,33H,3-6,9-14,17-19H2 |
| InChIKey | CSDFOQMGWNXYBJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|