C5H9NO2S — CID 156566229
(3E)-4-(sulfinoamino)penta-1,3-diene (PubChem CID 156566229) has the molecular formula C5H9NO2S and a molecular weight of 147.20 g/mol. Its IUPAC name is (3E)-4-(sulfinoamino)penta-1,3-diene.
| Compound Name | (3E)-4-(sulfinoamino)penta-1,3-diene |
|---|---|
| PubChem CID | 156566229 |
| Molecular Formula | C5H9NO2S |
| Molecular Weight | 147.20 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | (3E)-4-(sulfinoamino)penta-1,3-diene |
| SMILES | C=C/C=C(\C)NS(=O)O |
| InChI | InChI=1S/C5H9NO2S/c1-3-4-5(2)6-9(7)8/h3-4,6H,1H2,2H3,(H,7,8)/b5-4+ |
| InChIKey | SIVLNKPEXBBCEI-SNAWJCMRSA-N |
| XLogP | 0.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|