C15H27F2NO2 — CID 156566483
(E)-N-(2,2-dimethylpropyl)-2,2-difluoro-6-(2-methylpropoxy)hex-4-enamide (PubChem CID 156566483) has the molecular formula C15H27F2NO2 and a molecular weight of 291.38 g/mol. Its IUPAC name is (E)-N-(2,2-dimethylpropyl)-2,2-difluoro-6-(2-methylpropoxy)hex-4-enamide.
| Compound Name | (E)-N-(2,2-dimethylpropyl)-2,2-difluoro-6-(2-methylpropoxy)hex-4-enamide |
|---|---|
| PubChem CID | 156566483 |
| Molecular Formula | C15H27F2NO2 |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (E)-N-(2,2-dimethylpropyl)-2,2-difluoro-6-(2-methylpropoxy)hex-4-enamide |
| SMILES | CC(C)COC/C=C/CC(F)(F)C(=O)NCC(C)(C)C |
| InChI | InChI=1S/C15H27F2NO2/c1-12(2)10-20-9-7-6-8-15(16,17)13(19)18-11-14(3,4)5/h6-7,12H,8-11H2,1-5H3,(H,18,19)/b7-6+ |
| InChIKey | GUVACESZLRQBTF-VOTSOKGWSA-N |
| XLogP | 3.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|