C30H36N6O3 — CID 156566514
(1R,22R,25R)-16-acetyl-25-methyl-13-(2-methylpyrimidin-5-yl)-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione (PubChem CID 156566514) has the molecular formula C30H36N6O3 and a molecular weight of 528.66 g/mol. Its IUPAC name is (1R,22R,25R)-16-acetyl-25-methyl-13-(2-methylpyrimidin-5-yl)-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione.
| Compound Name | (1R,22R,25R)-16-acetyl-25-methyl-13-(2-methylpyrimidin-5-yl)-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione |
|---|---|
| PubChem CID | 156566514 |
| Molecular Formula | C30H36N6O3 |
| Molecular Weight | 528.66 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | (1R,22R,25R)-16-acetyl-25-methyl-13-(2-methylpyrimidin-5-yl)-3,17,18,21-tetrazapentacyclo[19.2.2.111,15.01,22.018,26]hexacosa-11(26),12,14,16-tetraene-4,20-dione |
| SMILES | CC(=O)c1nn2c3c(cc(-c4cnc(C)nc4)cc13)CCCCCCC(=O)NC[C@@]13C[C@@H](C)N(C(=O)C2)[C@@H]1C3 |
| InChI | InChI=1S/C30H36N6O3/c1-18-12-30-13-25(30)36(18)27(39)16-35-29-21(8-6-4-5-7-9-26(38)33-17-30)10-22(23-14-31-20(3)32-15-23)11-24(29)28(34-35)19(2)37/h10-11,14-15,18,25H,4-9,12-13,16-17H2,1-3H3,(H,33,38)/t18-,25-,30+/m1/s1 |
| InChIKey | ABFIUWJWPOZWLI-NIRLBZJPSA-N |
| XLogP | 4.01 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |