About N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide
N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide (PubChem CID 156566660) has the molecular formula C18H40N2O4S3
and a molecular weight of 444.73 g/mol. Its IUPAC name is N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide |
| PubChem CID | 156566660 |
| Molecular Formula | C18H40N2O4S3 |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide |
| SMILES | CCCC[C@H](C)NS(=O)(=O)C(C)CCC(C)(C)CCCNS(=O)(=O)C(C)S |
| InChI | InChI=1S/C18H40N2O4S3/c1-7-8-10-15(2)20-26(21,22)16(3)11-13-18(5,6)12-9-14-19-27(23,24)17(4)25/h15-17,19-20,25H,7-14H2,1-6H3/t15-,16?,17?/m0/s1 |
| InChIKey | ATIBZQPTBGGGFW-GTPINHCMSA-N |
| XLogP | 3.65 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide?
The IUPAC name of N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide (CID 156566660) is N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide.
What is the SMILES notation for N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide?
The canonical SMILES for N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide is CCCC[C@H](C)NS(=O)(=O)C(C)CCC(C)(C)CCCNS(=O)(=O)C(C)S.
What is the InChIKey of N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide?
The InChIKey is ATIBZQPTBGGGFW-GTPINHCMSA-N. The full InChI is InChI=1S/C18H40N2O4S3/c1-7-8-10-15(2)20-26(21,22)16(3)11-13-18(5,6)12-9-14-19-27(23,24)17(4)25/h15-17,19-20,25H,7-14H2,1-6H3/t15-,16?,17?/m0/s1.
What are the key properties of N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide?
N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide has a molecular weight of 444.73 g/mol, XLogP of 3.65, 15 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-hexan-2-yl]-5,5-dimethyl-8-(1-sulfanylethylsulfonylamino)octane-2-sulfonamide is sourced from PubChem (CID 156566660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).