About N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide
N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide (PubChem CID 156566666) has the molecular formula C8H19NO3S
and a molecular weight of 209.31 g/mol. Its IUPAC name is N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide |
| PubChem CID | 156566666 |
| Molecular Formula | C8H19NO3S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide |
| SMILES | CC(C)C(C)(CO)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C8H19NO3S/c1-7(2)8(3,6-10)9(4)13(5,11)12/h7,10H,6H2,1-5H3 |
| InChIKey | PVUQBMVFSMZKQQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide?
The IUPAC name of N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide (CID 156566666) is N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide.
What is the SMILES notation for N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide?
The canonical SMILES for N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide is CC(C)C(C)(CO)N(C)S(C)(=O)=O.
What is the InChIKey of N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide?
The InChIKey is PVUQBMVFSMZKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3S/c1-7(2)8(3,6-10)9(4)13(5,11)12/h7,10H,6H2,1-5H3.
What are the key properties of N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide?
N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide has a molecular weight of 209.31 g/mol, XLogP of 0.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-2,3-dimethylbutan-2-yl)-N-methylmethanesulfonamide is sourced from PubChem (CID 156566666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).