About N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine
N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine (PubChem CID 156566674) has the molecular formula C13H25FN2
and a molecular weight of 228.35 g/mol. Its IUPAC name is N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine.
Molecular Properties
| Compound Name | N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine |
| PubChem CID | 156566674 |
| Molecular Formula | C13H25FN2 |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine |
| SMILES | C[C@@H]1C[C@@]2(CNCCF)CC2N1C(C)(C)C |
| InChI | InChI=1S/C13H25FN2/c1-10-7-13(9-15-6-5-14)8-11(13)16(10)12(2,3)4/h10-11,15H,5-9H2,1-4H3/t10-,11?,13+/m1/s1 |
| InChIKey | WTUUOCAUGVPVGZ-XEEJXUNPSA-N |
| XLogP | 2.20 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine?
The IUPAC name of N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine (CID 156566674) is N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine.
What is the SMILES notation for N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine?
The canonical SMILES for N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine is C[C@@H]1C[C@@]2(CNCCF)CC2N1C(C)(C)C.
What is the InChIKey of N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine?
The InChIKey is WTUUOCAUGVPVGZ-XEEJXUNPSA-N. The full InChI is InChI=1S/C13H25FN2/c1-10-7-13(9-15-6-5-14)8-11(13)16(10)12(2,3)4/h10-11,15H,5-9H2,1-4H3/t10-,11?,13+/m1/s1.
What are the key properties of N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine?
N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine has a molecular weight of 228.35 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(3R,5R)-2-tert-butyl-3-methyl-2-azabicyclo[3.1.0]hexan-5-yl]methyl]-2-fluoroethanamine is sourced from PubChem (CID 156566674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).