C31H36BrN7O5 — CID 156566747
(1R,3S,5S)-2-[2-[3-acetyl-6-(pent-4-enylcarbamoylamino)indazol-1-yl]acetyl]-N-(6-bromo-3-methyl-2-pyridinyl)-5-(methoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 156566747) has the molecular formula C31H36BrN7O5 and a molecular weight of 666.58 g/mol. Its IUPAC name is (1R,3S,5S)-2-[2-[3-acetyl-6-(pent-4-enylcarbamoylamino)indazol-1-yl]acetyl]-N-(6-bromo-3-methyl-2-pyridinyl)-5-(methoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5S)-2-[2-[3-acetyl-6-(pent-4-enylcarbamoylamino)indazol-1-yl]acetyl]-N-(6-bromo-3-methyl-2-pyridinyl)-5-(methoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 156566747 |
| Molecular Formula | C31H36BrN7O5 |
| Molecular Weight | 666.58 g/mol |
| Exact Mass | 665.20 |
| IUPAC Name | (1R,3S,5S)-2-[2-[3-acetyl-6-(pent-4-enylcarbamoylamino)indazol-1-yl]acetyl]-N-(6-bromo-3-methyl-2-pyridinyl)-5-(methoxymethyl)-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | C=CCCCNC(=O)Nc1ccc2c(C(C)=O)nn(CC(=O)N3[C@H](C(=O)Nc4nc(Br)ccc4C)C[C@@]4(COC)C[C@@H]34)c2c1 |
| InChI | InChI=1S/C31H36BrN7O5/c1-5-6-7-12-33-30(43)34-20-9-10-21-22(13-20)38(37-27(21)19(3)40)16-26(41)39-23(14-31(17-44-4)15-24(31)39)29(42)36-28-18(2)8-11-25(32)35-28/h5,8-11,13,23-24H,1,6-7,12,14-17H2,2-4H3,(H2,33,34,43)(H,35,36,42)/t23-,24+,31-/m0/s1 |
| InChIKey | HVFOVCKZDKWHNK-JLELKNTQSA-N |
| XLogP | 4.44 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|