C10H11NO5S — CID 156567058
N-hydroxy-4-methoxy-7-oxabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-8-sulfonamide (PubChem CID 156567058) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is N-hydroxy-4-methoxy-7-oxabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-8-sulfonamide.
| Compound Name | N-hydroxy-4-methoxy-7-oxabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-8-sulfonamide |
|---|---|
| PubChem CID | 156567058 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | N-hydroxy-4-methoxy-7-oxabicyclo[4.3.1]deca-2,4,6(10),8-tetraene-8-sulfonamide |
| SMILES | COC1=CC2=CC(C=C1)C=C(S(=O)(=O)NO)O2 |
| InChI | InChI=1S/C10H11NO5S/c1-15-8-3-2-7-4-9(6-8)16-10(5-7)17(13,14)11-12/h2-7,11-12H,1H3 |
| InChIKey | CAAZMYJTAWGMIR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|