C22H14F4O3 — CID 156568508
(4-ethenyl-2,3,5,6-tetrafluorophenyl) 4-benzoylcyclohexa-2,4-diene-1-carboxylate (PubChem CID 156568508) has the molecular formula C22H14F4O3 and a molecular weight of 402.34 g/mol. Its IUPAC name is (4-ethenyl-2,3,5,6-tetrafluorophenyl) 4-benzoylcyclohexa-2,4-diene-1-carboxylate.
| Compound Name | (4-ethenyl-2,3,5,6-tetrafluorophenyl) 4-benzoylcyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 156568508 |
| Molecular Formula | C22H14F4O3 |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (4-ethenyl-2,3,5,6-tetrafluorophenyl) 4-benzoylcyclohexa-2,4-diene-1-carboxylate |
| SMILES | C=Cc1c(F)c(F)c(OC(=O)C2C=CC(C(=O)c3ccccc3)=CC2)c(F)c1F |
| InChI | InChI=1S/C22H14F4O3/c1-2-15-16(23)18(25)21(19(26)17(15)24)29-22(28)14-10-8-13(9-11-14)20(27)12-6-4-3-5-7-12/h2-10,14H,1,11H2 |
| InChIKey | GXEZEBTWBFRZIA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|