C36H10N10 — CID 156568572
3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-bis(3,4-dicyanophenyl)-3H-s-indacene-1,7-dicarbonitrile (PubChem CID 156568572) has the molecular formula C36H10N10 and a molecular weight of 582.55 g/mol. Its IUPAC name is 3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-bis(3,4-dicyanophenyl)-3H-s-indacene-1,7-dicarbonitrile.
| Compound Name | 3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-bis(3,4-dicyanophenyl)-3H-s-indacene-1,7-dicarbonitrile |
|---|---|
| PubChem CID | 156568572 |
| Molecular Formula | C36H10N10 |
| Molecular Weight | 582.55 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 3-(dicyanomethyl)-5-(dicyanomethylidene)-2,6-bis(3,4-dicyanophenyl)-3H-s-indacene-1,7-dicarbonitrile |
| SMILES | N#CC(C#N)=C1C(c2ccc(C#N)c(C#N)c2)=C(C#N)c2cc3c(cc21)C(C(C#N)C#N)C(c1ccc(C#N)c(C#N)c1)=C3C#N |
| InChI | InChI=1S/C36H10N10/c37-9-21-3-1-19(5-23(21)11-39)33-31(17-45)27-7-28-30(8-29(27)35(33)25(13-41)14-42)36(26(15-43)16-44)34(32(28)18-46)20-2-4-22(10-38)24(6-20)12-40/h1-8,25,35H |
| InChIKey | JYYAIVNAABAWIE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 237.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|