About 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one
2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one (PubChem CID 156568699) has the molecular formula C33H24N2O
and a molecular weight of 464.57 g/mol. Its IUPAC name is 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one |
| PubChem CID | 156568699 |
| Molecular Formula | C33H24N2O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one |
| SMILES | C=C1N(c2ccc(-c3ccccc3)cc2)C(=O)c2ccccc2N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H24N2O/c1-24-34(29-20-16-27(17-21-29)25-10-4-2-5-11-25)32-15-9-8-14-31(32)33(36)35(24)30-22-18-28(19-23-30)26-12-6-3-7-13-26/h2-23H,1H2 |
| InChIKey | ZXCNEIPCULMLCE-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one?
The IUPAC name of 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one (CID 156568699) is 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one.
What is the SMILES notation for 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one?
The canonical SMILES for 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one is C=C1N(c2ccc(-c3ccccc3)cc2)C(=O)c2ccccc2N1c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one?
The InChIKey is ZXCNEIPCULMLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H24N2O/c1-24-34(29-20-16-27(17-21-29)25-10-4-2-5-11-25)32-15-9-8-14-31(32)33(36)35(24)30-22-18-28(19-23-30)26-12-6-3-7-13-26/h2-23H,1H2.
What are the key properties of 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one?
2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one has a molecular weight of 464.57 g/mol, XLogP of 8.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-1,3-bis(4-phenylphenyl)quinazolin-4-one is sourced from PubChem (CID 156568699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).