C64H37N5O7 — CID 156568765
1-[10-[3-[6-(4-dibenzofuran-4-yl-2,3-dioxoquinoxalin-1-yl)dibenzofuran-3-yl]phenyl]phenoxazin-3-yl]-4-phenylquinoxaline-2,3-dione (PubChem CID 156568765) has the molecular formula C64H37N5O7 and a molecular weight of 988.03 g/mol. Its IUPAC name is 1-[10-[3-[6-(4-dibenzofuran-4-yl-2,3-dioxoquinoxalin-1-yl)dibenzofuran-3-yl]phenyl]phenoxazin-3-yl]-4-phenylquinoxaline-2,3-dione.
| Compound Name | 1-[10-[3-[6-(4-dibenzofuran-4-yl-2,3-dioxoquinoxalin-1-yl)dibenzofuran-3-yl]phenyl]phenoxazin-3-yl]-4-phenylquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 156568765 |
| Molecular Formula | C64H37N5O7 |
| Molecular Weight | 988.03 g/mol |
| Exact Mass | 987.27 |
| IUPAC Name | 1-[10-[3-[6-(4-dibenzofuran-4-yl-2,3-dioxoquinoxalin-1-yl)dibenzofuran-3-yl]phenyl]phenoxazin-3-yl]-4-phenylquinoxaline-2,3-dione |
| SMILES | O=c1c(=O)n(-c2ccc3c(c2)Oc2ccccc2N3c2cccc(-c3ccc4c(c3)oc3c(-n5c(=O)c(=O)n(-c6cccc7c6oc6ccccc67)c6ccccc65)cccc34)c2)c2ccccc2n1-c1ccccc1 |
| InChI | InChI=1S/C64H37N5O7/c70-61-62(71)67(48-23-6-5-22-47(48)66(61)40-16-2-1-3-17-40)42-32-34-52-58(37-42)74-56-30-11-9-26-51(56)65(52)41-18-12-15-38(35-41)39-31-33-44-46-21-14-28-54(60(46)76-57(44)36-39)69-50-25-8-7-24-49(50)68(63(72)64(69)73)53-27-13-20-45-43-19-4-10-29-55(43)75-59(45)53/h1-37H |
| InChIKey | AXKTWUPAEKKRER-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 126.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.03 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|