About (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine
(4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine (PubChem CID 156568784) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine.
Molecular Properties
| Compound Name | (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine |
| PubChem CID | 156568784 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine |
| SMILES | CC/C=C1/CNN(C)/C1=C/CC |
| InChI | InChI=1S/C10H18N2/c1-4-6-9-8-11-12(3)10(9)7-5-2/h6-7,11H,4-5,8H2,1-3H3/b9-6-,10-7+ |
| InChIKey | FCOSEXTXFGBHLD-PCCLLEMOSA-N |
| XLogP | 2.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine?
The IUPAC name of (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine (CID 156568784) is (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine.
What is the SMILES notation for (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine?
The canonical SMILES for (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine is CC/C=C1/CNN(C)/C1=C/CC.
What is the InChIKey of (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine?
The InChIKey is FCOSEXTXFGBHLD-PCCLLEMOSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-6-9-8-11-12(3)10(9)7-5-2/h6-7,11H,4-5,8H2,1-3H3/b9-6-,10-7+.
What are the key properties of (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine?
(4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine has a molecular weight of 166.27 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,5E)-1-methyl-4,5-di(propylidene)pyrazolidine is sourced from PubChem (CID 156568784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).