About 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione
1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione (PubChem CID 156569359) has the molecular formula C16H20N2O6
and a molecular weight of 336.34 g/mol. Its IUPAC name is 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione |
| PubChem CID | 156569359 |
| Molecular Formula | C16H20N2O6 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1CC1CCC(C(O)ON2C(=O)CCC2=O)CC1 |
| InChI | InChI=1S/C16H20N2O6/c19-12-5-6-13(20)17(12)9-10-1-3-11(4-2-10)16(23)24-18-14(21)7-8-15(18)22/h5-6,10-11,16,23H,1-4,7-9H2 |
| InChIKey | DULOZVLEXFSIDP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione?
The IUPAC name of 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione (CID 156569359) is 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione.
What is the SMILES notation for 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione?
The canonical SMILES for 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione is O=C1C=CC(=O)N1CC1CCC(C(O)ON2C(=O)CCC2=O)CC1.
What is the InChIKey of 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione?
The InChIKey is DULOZVLEXFSIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O6/c19-12-5-6-13(20)17(12)9-10-1-3-11(4-2-10)16(23)24-18-14(21)7-8-15(18)22/h5-6,10-11,16,23H,1-4,7-9H2.
What are the key properties of 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione?
1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione has a molecular weight of 336.34 g/mol, XLogP of 0.12, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-[(2,5-dioxopyrrolidin-1-yl)oxy-hydroxymethyl]cyclohexyl]methyl]pyrrole-2,5-dione is sourced from PubChem (CID 156569359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).