C27H28NO3PS3 — CID 156569537
[1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl]sulfanylmethanedithioic acid (PubChem CID 156569537) has the molecular formula C27H28NO3PS3 and a molecular weight of 541.70 g/mol. Its IUPAC name is [1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl]sulfanylmethanedithioic acid.
| Compound Name | [1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl]sulfanylmethanedithioic acid |
|---|---|
| PubChem CID | 156569537 |
| Molecular Formula | C27H28NO3PS3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | [1-(3-diphenylphosphorylcarbonyl-2,4,6-trimethylanilino)-2-methyl-1-oxopropan-2-yl]sulfanylmethanedithioic acid |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(c2ccccc2)c2ccccc2)c(C)c1NC(=O)C(C)(C)SC(=S)S |
| InChI | InChI=1S/C27H28NO3PS3/c1-17-16-18(2)23(28-25(30)27(4,5)35-26(33)34)19(3)22(17)24(29)32(31,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-16H,1-5H3,(H,28,30)(H,33,34) |
| InChIKey | KXTAVMRUJFGDFU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|