C20H23N7O4S — CID 156569645
3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylimino]-5,6-dihydro-1H-pyrimidin-6-yl]imidazo[2,1-b][1,3]oxazol-6-yl]phenol (PubChem CID 156569645) has the molecular formula C20H23N7O4S and a molecular weight of 457.52 g/mol. Its IUPAC name is 3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylimino]-5,6-dihydro-1H-pyrimidin-6-yl]imidazo[2,1-b][1,3]oxazol-6-yl]phenol.
| Compound Name | 3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylimino]-5,6-dihydro-1H-pyrimidin-6-yl]imidazo[2,1-b][1,3]oxazol-6-yl]phenol |
|---|---|
| PubChem CID | 156569645 |
| Molecular Formula | C20H23N7O4S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[5-[2-[2-(1,1-dioxo-1,2,6-thiadiazinan-2-yl)ethylimino]-5,6-dihydro-1H-pyrimidin-6-yl]imidazo[2,1-b][1,3]oxazol-6-yl]phenol |
| SMILES | O=S1(=O)NCCCN1CC/N=C1\N=CCC(c2c(-c3cccc(O)c3)nc3occn23)N1 |
| InChI | InChI=1S/C20H23N7O4S/c28-15-4-1-3-14(13-15)17-18(27-11-12-31-20(27)25-17)16-5-7-21-19(24-16)22-8-10-26-9-2-6-23-32(26,29)30/h1,3-4,7,11-13,16,23,28H,2,5-6,8-10H2,(H,22,24) |
| InChIKey | CBTXKCPZYUPHNK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|