C12H15ClFNO — CID 156569845
N-[(3-chloro-2-fluorophenyl)methyl]pentanamide (PubChem CID 156569845) has the molecular formula C12H15ClFNO and a molecular weight of 243.71 g/mol. Its IUPAC name is N-[(3-chloro-2-fluorophenyl)methyl]pentanamide.
| Compound Name | N-[(3-chloro-2-fluorophenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 156569845 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | N-[(3-chloro-2-fluorophenyl)methyl]pentanamide |
| SMILES | CCCCC(=O)NCc1cccc(Cl)c1F |
| InChI | InChI=1S/C12H15ClFNO/c1-2-3-7-11(16)15-8-9-5-4-6-10(13)12(9)14/h4-6H,2-3,7-8H2,1H3,(H,15,16) |
| InChIKey | NFSAIVRSXDWVLY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |