About O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate
O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate (PubChem CID 156570061) has the molecular formula C27H25FN2O3S
and a molecular weight of 476.57 g/mol. Its IUPAC name is O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate.
Molecular Properties
| Compound Name | O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate |
| PubChem CID | 156570061 |
| Molecular Formula | C27H25FN2O3S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate |
| SMILES | CCOC(=S)Cc1ccccc1OCc1cc(-c2cccc(CN)c2F)c2ccn(C=O)c2c1 |
| InChI | InChI=1S/C27H25FN2O3S/c1-2-32-26(34)14-19-6-3-4-9-25(19)33-16-18-12-23(21-10-11-30(17-31)24(21)13-18)22-8-5-7-20(15-29)27(22)28/h3-13,17H,2,14-16,29H2,1H3 |
| InChIKey | ATRLBGBDKCPRNZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate?
The IUPAC name of O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate (CID 156570061) is O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate.
What is the SMILES notation for O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate?
The canonical SMILES for O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate is CCOC(=S)Cc1ccccc1OCc1cc(-c2cccc(CN)c2F)c2ccn(C=O)c2c1.
What is the InChIKey of O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate?
The InChIKey is ATRLBGBDKCPRNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25FN2O3S/c1-2-32-26(34)14-19-6-3-4-9-25(19)33-16-18-12-23(21-10-11-30(17-31)24(21)13-18)22-8-5-7-20(15-29)27(22)28/h3-13,17H,2,14-16,29H2,1H3.
What are the key properties of O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate?
O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate has a molecular weight of 476.57 g/mol, XLogP of 5.43, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-1-formylindol-6-yl]methoxy]phenyl]ethanethioate is sourced from PubChem (CID 156570061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).