C11H24N+ — CID 15657086
1,1,2,2,6,6-hexamethylpiperidin-1-ium (PubChem CID 15657086) has the molecular formula C11H24N+ and a molecular weight of 170.32 g/mol. Its IUPAC name is 1,1,2,2,6,6-hexamethylpiperidin-1-ium.
| Compound Name | 1,1,2,2,6,6-hexamethylpiperidin-1-ium |
|---|---|
| PubChem CID | 15657086 |
| Molecular Formula | C11H24N+ |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.19 |
| IUPAC Name | 1,1,2,2,6,6-hexamethylpiperidin-1-ium |
| SMILES | CC1(C)CCCC(C)(C)[N+]1(C)C |
| InChI | InChI=1S/C11H24N/c1-10(2)8-7-9-11(3,4)12(10,5)6/h7-9H2,1-6H3/q+1 |
| InChIKey | NKIOEUCYXGNBML-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|