About N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine
N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine (PubChem CID 156571111) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine.
Molecular Properties
| Compound Name | N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine |
| PubChem CID | 156571111 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine |
| SMILES | C=CC1C=Cc2cccnc2C1/N=C/C |
| InChI | InChI=1S/C13H14N2/c1-3-10-7-8-11-6-5-9-15-13(11)12(10)14-4-2/h3-10,12H,1H2,2H3/b14-4+ |
| InChIKey | WNQVDQXJBCKTIX-LNKIKWGQSA-N |
| XLogP | 3.04 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine?
The IUPAC name of N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine (CID 156571111) is N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine.
What is the SMILES notation for N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine?
The canonical SMILES for N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine is C=CC1C=Cc2cccnc2C1/N=C/C.
What is the InChIKey of N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine?
The InChIKey is WNQVDQXJBCKTIX-LNKIKWGQSA-N. The full InChI is InChI=1S/C13H14N2/c1-3-10-7-8-11-6-5-9-15-13(11)12(10)14-4-2/h3-10,12H,1H2,2H3/b14-4+.
What are the key properties of N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine?
N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine has a molecular weight of 198.27 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-ethenyl-7,8-dihydroquinolin-8-yl)ethanimine is sourced from PubChem (CID 156571111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).