C12H23NO — CID 15657128
(2E,5E)-4-[(dimethylamino)methyl]-3,5-dimethylhepta-2,5-dien-4-ol (PubChem CID 15657128) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (2E,5E)-4-[(dimethylamino)methyl]-3,5-dimethylhepta-2,5-dien-4-ol.
| Compound Name | (2E,5E)-4-[(dimethylamino)methyl]-3,5-dimethylhepta-2,5-dien-4-ol |
|---|---|
| PubChem CID | 15657128 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (2E,5E)-4-[(dimethylamino)methyl]-3,5-dimethylhepta-2,5-dien-4-ol |
| SMILES | C/C=C(\C)C(O)(CN(C)C)/C(C)=C/C |
| InChI | InChI=1S/C12H23NO/c1-7-10(3)12(14,9-13(5)6)11(4)8-2/h7-8,14H,9H2,1-6H3/b10-7+,11-8+ |
| InChIKey | BKZMWPLPFAYICO-AMMQDNIMSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|