C9H12N2 — CID 156571563
5-methyl-3,4,4a,5-tetrahydro-1,6-naphthyridine (PubChem CID 156571563) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-methyl-3,4,4a,5-tetrahydro-1,6-naphthyridine.
| Compound Name | 5-methyl-3,4,4a,5-tetrahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 156571563 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 5-methyl-3,4,4a,5-tetrahydro-1,6-naphthyridine |
| SMILES | CC1N=CC=C2N=CCCC21 |
| InChI | InChI=1S/C9H12N2/c1-7-8-3-2-5-11-9(8)4-6-10-7/h4-8H,2-3H2,1H3 |
| InChIKey | QKJNSKQXAIIKIH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |