About N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine
N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 156571741) has the molecular formula C11H16N4
and a molecular weight of 204.28 g/mol. Its IUPAC name is N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| PubChem CID | 156571741 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | CC(C)c1c[nH]c2cnc(N(C)C)nc12 |
| InChI | InChI=1S/C11H16N4/c1-7(2)8-5-12-9-6-13-11(15(3)4)14-10(8)9/h5-7,12H,1-4H3 |
| InChIKey | JYMFMOLUVRDHOY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The IUPAC name of N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine (CID 156571741) is N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine.
What is the SMILES notation for N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The canonical SMILES for N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine is CC(C)c1c[nH]c2cnc(N(C)C)nc12.
What is the InChIKey of N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
The InChIKey is JYMFMOLUVRDHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4/c1-7(2)8-5-12-9-6-13-11(15(3)4)14-10(8)9/h5-7,12H,1-4H3.
What are the key properties of N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine?
N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine has a molecular weight of 204.28 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-7-propan-2-yl-5H-pyrrolo[3,2-d]pyrimidin-2-amine is sourced from PubChem (CID 156571741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).