C17H16ClN3O — CID 15657185
(1R,3R)-3-azido-6-chloro-7-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 15657185) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is (1R,3R)-3-azido-6-chloro-7-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,3R)-3-azido-6-chloro-7-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 15657185 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (1R,3R)-3-azido-6-chloro-7-methoxy-1-phenyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1cc2c(cc1Cl)C[C@H](N=[N+]=[N-])C[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C17H16ClN3O/c1-22-17-10-15-12(8-16(17)18)7-13(20-21-19)9-14(15)11-5-3-2-4-6-11/h2-6,8,10,13-14H,7,9H2,1H3/t13-,14+/m0/s1 |
| InChIKey | GPNQJAHZOMZQNS-UONOGXRCSA-N |
| XLogP | 5.11 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|